* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX000107 |
| English Synonyms: | ZERENEX ZX000107 |
| MDL Number.: | MFCD00562703 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | Cl.Cl.CCCC1=CC=C(OCC(O)CN2CCN(C)CC2)C=C1 |
| InChi: | InChI=1S/C17H28N2O2.2ClH/c1-3-4-15-5-7-17(8-6-15)21-14-16(20)13-19-11-9-18(2)10-12-19;;/h5-8,16,20H,3-4,9-14H2,1-2H3;2*1H |
| InChiKey: | InChIKey=DWQSSSDAIJJAAZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.