* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | EMOLECULES 10090998 |
English Synonyms: | EMOLECULES 10090998 |
MDL Number.: | MFCD00562726 |
H bond acceptor: | 3 |
H bond donor: | 2 |
Smile: | CC(C)c1ccc(cc1)OCC(CNC(C)(C)C)O.Cl |
InChi: | InChI=1S/C16H27NO2.ClH/c1-12(2)13-6-8-15(9-7-13)19-11-14(18)10-17-16(3,4)5;/h6-9,12,14,17-18H,10-11H2,1-5H3;1H |
InChiKey: | InChIKey=USOIZYRWPYHWPM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.