* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB021550 |
English Synonyms: | VITAS-BB TBB021550 |
MDL Number.: | MFCD00567251 |
H bond acceptor: | 6 |
H bond donor: | 4 |
Smile: | OC1=CC(=CC(O)=C1)C(=O)N\N=C\C1=CC=CN1 |
InChi: | InChI=1S/C12H11N3O3/c16-10-4-8(5-11(17)6-10)12(18)15-14-7-9-2-1-3-13-9/h1-7,13,16-17H,(H,15,18)/b14-7+ |
InChiKey: | InChIKey=SYARZFNVSXMHAM-VGOFMYFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.