* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB018875 |
English Synonyms: | VITAS-BB TBB018875 |
MDL Number.: | MFCD00567265 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | [O-][N+](=O)C1=CC=CC(=C1)C(=O)N\N=C\C1=CC=C(Br)S1 |
InChi: | InChI=1S/C12H8BrN3O3S/c13-11-5-4-10(20-11)7-14-15-12(17)8-2-1-3-9(6-8)16(18)19/h1-7H,(H,15,17)/b14-7+ |
InChiKey: | InChIKey=NPMWGRLXMPLNMQ-VGOFMYFVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.