Molecular Structure:
CCD No.:CCD00142173
OTAVA-BB 1204678
Formula:C13 H15 N3 O S
MolWeight:261.348
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | OTAVA-BB 1204678 |
| English Synonyms： | OTAVA-BB 1204678 |
| MDL Number.： | MFCD00571428 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCOc1ccc(cc1)Cc2cnc(nc2N)S |
| InChi： | InChI=1S/C13H15N3OS/c1-2-17-11-5-3-9(4-6-11)7-10-8-15-13(18)16-12(10)14/h3-6,8H,2,7H2,1H3,(H3,14,15,16,18) |
| InChiKey： | InChIKey=ZCRMVPZWKLPRMS-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
