* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | FCHGROUP FCH117456 |
| English Synonyms: | FCHGROUP FCH117456 |
| MDL Number.: | MFCD00577605 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CC(CNS(=O)(=O)c1ccccc1[N+](=O)[O-])O |
| InChi: | InChI=1S/C9H12N2O5S/c1-7(12)6-10-17(15,16)9-5-3-2-4-8(9)11(13)14/h2-5,7,10,12H,6H2,1H3 |
| InChiKey: | InChIKey=KIRYIGBGISXGAX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.