* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB017134 |
English Synonyms: | VITAS-BB TBB017134 |
MDL Number.: | MFCD00580016 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | CCOC(=O)C1=C(NS(=O)(=O)C2=CC=CC=C2)SC2=C1CCCC2 |
InChi: | InChI=1S/C17H19NO4S2/c1-2-22-17(19)15-13-10-6-7-11-14(13)23-16(15)18-24(20,21)12-8-4-3-5-9-12/h3-5,8-9,18H,2,6-7,10-11H2,1H3 |
InChiKey: | InChIKey=CBQRZBXNKYYYEB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.