* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-CHLORO-1-(2-THIENYL)-1-NONANONE |
English Synonyms: | 9-CHLORO-1-(2-THIENYL)-1-NONANONE ; 9-CHLORO-1-(2-THIENYL)NONAN-1-ONE |
MDL Number.: | MFCD00582702 |
H bond acceptor: | 1 |
H bond donor: | 0 |
Smile: | c1cc(sc1)C(=O)CCCCCCCCCl |
InChi: | InChI=1S/C13H19ClOS/c14-10-6-4-2-1-3-5-8-12(15)13-9-7-11-16-13/h7,9,11H,1-6,8,10H2 |
InChiKey: | InChIKey=XUWGZRUTUDRZKR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.