* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 9-METHYL[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE |
CAS: | 272776-07-5 |
English Synonyms: | 9-METHYL[1,2,5]OXADIAZOLO[3,4-F]CINNOLINE |
MDL Number.: | MFCD00582798 |
H bond acceptor: | 5 |
H bond donor: | 0 |
Smile: | Cc1cnnc2c1c3c(cc2)non3 |
InChi: | InChI=1S/C9H6N4O/c1-5-4-10-11-6-2-3-7-9(8(5)6)13-14-12-7/h2-4H,1H3 |
InChiKey: | InChIKey=NBNRXKLMMDXGPS-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.