* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB022881 |
| English Synonyms: | VITAS-BB TBB022881 |
| MDL Number.: | MFCD00585016 |
| H bond acceptor: | 6 |
| H bond donor: | 2 |
| Smile: | COC1=CC(=CC=C1NC(=O)\C=C\C1=CC=C(C=C1)C(C)C)C1=CC(OC)=C(NC(=O)\C=C\C2=CC=C(C=C2)C(C)C)C=C1 |
| InChi: | InChI=1S/C38H40N2O4/c1-25(2)29-13-7-27(8-14-29)11-21-37(41)39-33-19-17-31(23-35(33)43-5)32-18-20-34(36(24-32)44-6)40-38(42)22-12-28-9-15-30(16-10-28)26(3)4/h7-26H,1-6H3,(H,39,41)(H,40,42)/b21-11+,22-12+ |
| InChiKey: | InChIKey=ZOCDCPLSAKDYGL-XHQRYOPUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.