* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | 9-(3-METHOXYPHENYL)-3,3,6,6-TETRAMETHYL-3,4,5,6,7,9-HEXAHYDRO-1H-XANTHENE-1,8(2H)-DIONE |
| English Synonyms: | 9-(3-METHOXYPHENYL)-3,3,6,6-TETRAMETHYL-3,4,5,6,7,9-HEXAHYDRO-1H-XANTHENE-1,8(2H)-DIONE |
| MDL Number.: | MFCD00585068 |
| H bond acceptor: | 4 |
| H bond donor: | 0 |
| Smile: | CC1(CC2=C(C(C3=C(O2)CC(CC3=O)(C)C)c4cccc(c4)OC)C(=O)C1)C |
| InChi: | InChI=1S/C24H28O4/c1-23(2)10-16(25)21-18(12-23)28-19-13-24(3,4)11-17(26)22(19)20(21)14-7-6-8-15(9-14)27-5/h6-9,20H,10-13H2,1-5H3 |
| InChiKey: | InChIKey=PWAFNLBCSVUWHK-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.