* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB018822 |
English Synonyms: | VITAS-BB TBB018822 |
MDL Number.: | MFCD00585730 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CCCCCC(=O)NNC(=O)NC1=CC=CC=C1 |
InChi: | InChI=1S/C13H19N3O2/c1-2-3-5-10-12(17)15-16-13(18)14-11-8-6-4-7-9-11/h4,6-9H,2-3,5,10H2,1H3,(H,15,17)(H2,14,16,18) |
InChiKey: | InChIKey=MPYGDCKXIRMKRX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.