* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX000108 |
English Synonyms: | ZERENEX ZX000108 |
MDL Number.: | MFCD00586135 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cl.Cl.CCCC1=CC=C(OCC(O)CN2CCN(CC2)C2=CC=CC=C2)C=C1 |
InChi: | InChI=1S/C22H30N2O2.2ClH/c1-2-6-19-9-11-22(12-10-19)26-18-21(25)17-23-13-15-24(16-14-23)20-7-4-3-5-8-20;;/h3-5,7-12,21,25H,2,6,13-18H2,1H3;2*1H |
InChiKey: | InChIKey=WWOVHEYBRINEQJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.