* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB019122 |
English Synonyms: | VITAS-BB TBB019122 |
MDL Number.: | MFCD00587957 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | COC1=CC(=CC=C1NC(=O)C1=CC=CO1)C1=CC(OC)=C(NC(=O)C2=CC=CO2)C=C1 |
InChi: | InChI=1S/C24H20N2O6/c1-29-21-13-15(7-9-17(21)25-23(27)19-5-3-11-31-19)16-8-10-18(22(14-16)30-2)26-24(28)20-6-4-12-32-20/h3-14H,1-2H3,(H,25,27)(H,26,28) |
InChiKey: | InChIKey=VNMSUHJDUKVVOB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.