* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX000230 |
English Synonyms: | ZERENEX ZX000230 |
MDL Number.: | MFCD00588137 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | OC(=O)CCCN1C(=S)S\C(=C/C=C/C2=CC=CC=C2)C1=O |
InChi: | InChI=1S/C16H15NO3S2/c18-14(19)10-5-11-17-15(20)13(22-16(17)21)9-4-8-12-6-2-1-3-7-12/h1-4,6-9H,5,10-11H2,(H,18,19)/b8-4+,13-9- |
InChiKey: | InChIKey=QQSOHHXEKGNSCC-VEJZVKIUSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.