* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB018823 |
English Synonyms: | VITAS-BB TBB018823 |
MDL Number.: | MFCD00588147 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | CCCCCC(=O)NNC(=O)NC1=CC(Cl)=CC=C1 |
InChi: | InChI=1S/C13H18ClN3O2/c1-2-3-4-8-12(18)16-17-13(19)15-11-7-5-6-10(14)9-11/h5-7,9H,2-4,8H2,1H3,(H,16,18)(H2,15,17,19) |
InChiKey: | InChIKey=DENLKSYVQGGNLI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.