* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | OTAVA-BB 1152436 |
| English Synonyms: | OTAVA-BB 1152436 |
| MDL Number.: | MFCD00588447 |
| H bond acceptor: | 6 |
| H bond donor: | 3 |
| Smile: | OC(=O)\C=C/C(=O)NC1=CC(=CC=C1)C(O)=O |
| InChi: | InChI=1S/C11H9NO5/c13-9(4-5-10(14)15)12-8-3-1-2-7(6-8)11(16)17/h1-6H,(H,12,13)(H,14,15)(H,16,17)/b5-4- |
| InChiKey: | InChIKey=UXIAYWKXDXAWJB-PLNGDYQASA-N |
* If the product has intellectual property rights, a license granted is must or contact us.