* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX E/8013493 |
| English Synonyms: | ZERENEX E/8013493 |
| MDL Number.: | MFCD00588502 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | COc1cc(cc(c1OC)OC)C(=O)Nc2ccc(c(c2)C(=O)O)O |
| InChi: | InChI=1S/C17H17NO7/c1-23-13-6-9(7-14(24-2)15(13)25-3)16(20)18-10-4-5-12(19)11(8-10)17(21)22/h4-8,19H,1-3H3,(H,18,20)(H,21,22) |
| InChiKey: | InChIKey=TWRWHUQOKMGXET-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.