* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-AB000159 |
| English Synonyms: | ZERENEX ZX-AB000159 |
| MDL Number.: | MFCD00588594 |
| H bond acceptor: | 2 |
| H bond donor: | 1 |
| Smile: | C[C@]1([C@H](CCC1=C)CC(=O)O)CBr |
| InChi: | InChI=1S/C10H15BrO2/c1-7-3-4-8(5-9(12)13)10(7,2)6-11/h8H,1,3-6H2,2H3,(H,12,13)/t8-,10+/m1/s1 |
| InChiKey: | InChIKey=IACANXNJBCAXBM-SCZZXKLOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.