* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX ZX000096 |
English Synonyms: | ZERENEX ZX000096 |
MDL Number.: | MFCD00588811 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | Cl.Cl.OC(COC1=CC=C2C=CC=CC2=C1)CN1CCN(CC1)C1=CC=CC=C1 |
InChi: | InChI=1S/C23H26N2O2.2ClH/c26-22(18-27-23-11-10-19-6-4-5-7-20(19)16-23)17-24-12-14-25(15-13-24)21-8-2-1-3-9-21;;/h1-11,16,22,26H,12-15,17-18H2;2*1H |
InChiKey: | InChIKey=PJCLOAMKUQBAKT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.