* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023629 |
English Synonyms: | VITAS-BB TBB023629 |
MDL Number.: | MFCD00589090 |
H bond acceptor: | 10 |
H bond donor: | 2 |
Smile: | [O-][N+](=O)C1=C(CC2=C(C=C(NC(=O)C3=C(Cl)C=CC=C3)C=C2)[N+]([O-])=O)C=CC(NC(=O)C2=CC=CC=C2Cl)=C1 |
InChi: | InChI=1S/C27H18Cl2N4O6/c28-22-7-3-1-5-20(22)26(34)30-18-11-9-16(24(14-18)32(36)37)13-17-10-12-19(15-25(17)33(38)39)31-27(35)21-6-2-4-8-23(21)29/h1-12,14-15H,13H2,(H,30,34)(H,31,35) |
InChiKey: | InChIKey=JDYDGHWSJYMOPZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.