* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB023313 |
English Synonyms: | VITAS-BB TBB023313 |
MDL Number.: | MFCD00589530 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | OC(=O)C1C2OC(C=C2)C1C(=O)NC1=CC=C(Cl)C=C1 |
InChi: | InChI=1S/C14H12ClNO4/c15-7-1-3-8(4-2-7)16-13(17)11-9-5-6-10(20-9)12(11)14(18)19/h1-6,9-12H,(H,16,17)(H,18,19) |
InChiKey: | InChIKey=ONILNZAYAKHDQE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.