* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB018852 |
English Synonyms: | VITAS-BB TBB018852 |
MDL Number.: | MFCD00593562 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | O=C(N\N=C\C1=CC=C2C=CC=CC2=C1)C1=CC=C(C=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C24H18N2O/c27-24(22-14-12-21(13-15-22)19-6-2-1-3-7-19)26-25-17-18-10-11-20-8-4-5-9-23(20)16-18/h1-17H,(H,26,27)/b25-17+ |
InChiKey: | InChIKey=WFEBNHCRWGXELH-KOEQRZSOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.