* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024343 |
English Synonyms: | VITAS-BB TBB024343 |
MDL Number.: | MFCD00593665 |
H bond acceptor: | 10 |
H bond donor: | 1 |
Smile: | CCCCOC(=O)C1=CC=C(NC(=O)C2=CC=C(C=C2[N+]([O-])=O)[N+]([O-])=O)C=C1 |
InChi: | InChI=1S/C18H17N3O7/c1-2-3-10-28-18(23)12-4-6-13(7-5-12)19-17(22)15-9-8-14(20(24)25)11-16(15)21(26)27/h4-9,11H,2-3,10H2,1H3,(H,19,22) |
InChiKey: | InChIKey=XTUUJOHKSGLHCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.