* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023383 |
English Synonyms: | VITAS-BB TBB023383 |
MDL Number.: | MFCD00594140 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | COC1=CC(NC(=O)C2C3OC(C=C3)C2C(O)=O)=C(OC)C=C1Cl |
InChi: | InChI=1S/C16H16ClNO6/c1-22-11-6-8(12(23-2)5-7(11)17)18-15(19)13-9-3-4-10(24-9)14(13)16(20)21/h3-6,9-10,13-14H,1-2H3,(H,18,19)(H,20,21) |
InChiKey: | InChIKey=LHMHDOPIYYXELT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.