* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/8011049 |
English Synonyms: | ZERENEX E/8011049 |
MDL Number.: | MFCD00594695 |
H bond acceptor: | 5 |
H bond donor: | 3 |
Smile: | c1cc(ccc1C(=O)Nc2ccc(c(c2)C(=O)O)O)Cl |
InChi: | InChI=1S/C14H10ClNO4/c15-9-3-1-8(2-4-9)13(18)16-10-5-6-12(17)11(7-10)14(19)20/h1-7,17H,(H,16,18)(H,19,20) |
InChiKey: | InChIKey=DSPYIEZTQSDZHJ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.