* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB024247 |
English Synonyms: | VITAS-BB TBB024247 |
MDL Number.: | MFCD00595073 |
H bond acceptor: | 5 |
H bond donor: | 1 |
Smile: | OC(=O)C1C2OC(C=C2)C1C(=O)N1CCCC1 |
InChi: | InChI=1S/C12H15NO4/c14-11(13-5-1-2-6-13)9-7-3-4-8(17-7)10(9)12(15)16/h3-4,7-10H,1-2,5-6H2,(H,15,16) |
InChiKey: | InChIKey=KTNICQRYSGMQIW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.