* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | CYCLOPENTOLATE |
| CAS: | 512-15-2 |
| English Synonyms: | CYCLOPENTOLATE |
| MDL Number.: | MFCD00599448 |
| H bond acceptor: | 4 |
| H bond donor: | 1 |
| Smile: | CN(C)CCOC(=O)C(c1ccccc1)C2(CCCC2)O |
| InChi: | InChI=1S/C17H25NO3/c1-18(2)12-13-21-16(19)15(14-8-4-3-5-9-14)17(20)10-6-7-11-17/h3-5,8-9,15,20H,6-7,10-13H2,1-2H3 |
| InChiKey: | InChIKey=SKYSRIRYMSLOIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.