* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | DOXEPIN |
| CAS: | 1668-19-5 ;3607-18-9 |
| English Synonyms: | Z-DOXEPIN ; DOXEPIN ; CIDOXEPIN |
| MDL Number.: | MFCD00599467 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CN(C)CC/C=C\1/c2ccccc2COc3c1cccc3 |
| InChi: | InChI=1S/C19H21NO/c1-20(2)13-7-11-17-16-9-4-3-8-15(16)14-21-19-12-6-5-10-18(17)19/h3-6,8-12H,7,13-14H2,1-2H3/b17-11- |
| InChiKey: | InChIKey=ODQWQRRAPPTVAG-BOPFTXTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.