* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | ZERENEX ZX-CF004944 |
| English Synonyms: | ZERENEX ZX-CF004944 |
| MDL Number.: | MFCD00599471 |
| H bond acceptor: | 4 |
| H bond donor: | 4 |
| Smile: | CNC[C@H](c1ccc(c(c1)O)O)O |
| InChi: | InChI=1S/C9H13NO3/c1-10-5-9(13)6-2-3-7(11)8(12)4-6/h2-4,9-13H,5H2,1H3/t9-/m1/s1 |
| InChiKey: | InChIKey=UCTWMZQNUQWSLP-SECBINFHSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.