* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | MIANSERIN |
CAS: | 24219-97-4 |
English Synonyms: | MIANSERINE ; MIANSERIN |
MDL Number.: | MFCD00600076 |
H bond acceptor: | 2 |
H bond donor: | 0 |
Smile: | CN1CCN2c3ccccc3Cc4ccccc4C2C1 |
InChi: | InChI=1S/C18H20N2/c1-19-10-11-20-17-9-5-3-7-15(17)12-14-6-2-4-8-16(14)18(20)13-19/h2-9,18H,10-13H2,1H3 |
InChiKey: | InChIKey=UEQUQVLFIPOEMF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.