* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB020301 |
| English Synonyms: | VITAS-BB TBB020301 |
| MDL Number.: | MFCD00603542 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CN1C(C)=CC(C)=[N+]1C |
| InChi: | InChI=1S/C7H13N2/c1-6-5-7(2)9(4)8(6)3/h5H,1-4H3/q+1 |
| InChiKey: | InChIKey=ZMKHDVWIHTXNTM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.