* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB015390 |
English Synonyms: | VITAS-BB TBB015390 |
MDL Number.: | MFCD00603590 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CCN1\C(C=CC2=C1C=CC(C)=C2)=C1/OC(=S)N(C)C1=O |
InChi: | InChI=1S/C16H16N2O2S/c1-4-18-12-7-5-10(2)9-11(12)6-8-13(18)14-15(19)17(3)16(21)20-14/h5-9H,4H2,1-3H3/b14-13- |
InChiKey: | InChIKey=CTPQVWOICBPXMF-YPKPFQOOSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.