* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | 7-METHYL-4H,5H,6H-[1,2,5]OXADIAZOLO[3,4-B][1,4]DIAZEPIN-5-ONE |
English Synonyms: | 7-METHYL-4H,5H,6H-[1,2,5]OXADIAZOLO[3,4-B][1,4]DIAZEPIN-5-ONE ; ZERENEX E/4039441 ; 7-METHYL-4H,6H-[1,2,5]OXADIAZOLO[3,4-B][1,4]DIAZEPIN-5-ONE |
MDL Number.: | MFCD00604311 |
H bond acceptor: | 6 |
H bond donor: | 1 |
Smile: | CC1=Nc2c(non2)NC(=O)C1 |
InChi: | InChI=1S/C6H6N4O2/c1-3-2-4(11)8-6-5(7-3)9-12-10-6/h2H2,1H3,(H,8,10,11) |
InChiKey: | InChIKey=WHUKWURZNHHQCT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.