Molecular Structure:
CCD No.:CCD00144801
ZERENEX E/6022277
Formula:C16 H10 Cl2 N4 O3
MolWeight:377.186
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6022277 |
| English Synonyms： | ZERENEX E/6022277 |
| MDL Number.： | MFCD00604323 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | c1ccc(c(c1)C(=O)Nc2c(non2)NC(=O)c3ccccc3Cl)Cl |
| InChi： | InChI=1S/C16H10Cl2N4O3/c17-11-7-3-1-5-9(11)15(23)19-13-14(22-25-21-13)20-16(24)10-6-2-4-8-12(10)18/h1-8H,(H,19,21,23)(H,20,22,24) |
| InChiKey： | InChIKey=HPLLVOOBOQVSHT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
