Molecular Structure:
CCD No.:CCD00144893
ZERENEX E/8010888
Formula:C15 H12 I N O3
MolWeight:381.164
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/8010888 |
| English Synonyms： | ZERENEX E/8010888 |
| MDL Number.： | MFCD00606686 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | Cc1cc(ccc1NC(=O)c2ccccc2I)C(=O)O |
| InChi： | InChI=1S/C15H12INO3/c1-9-8-10(15(19)20)6-7-13(9)17-14(18)11-4-2-3-5-12(11)16/h2-8H,1H3,(H,17,18)(H,19,20) |
| InChiKey： | InChIKey=MRMGAGZSODHQLL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
