* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB018954 |
English Synonyms: | VITAS-BB TBB018954 |
MDL Number.: | MFCD00614769 |
H bond acceptor: | 4 |
H bond donor: | 2 |
Smile: | OC1=C(\C=N\NC(=O)C2=CC=C(Cl)C=C2Cl)C2=C(C=CC=C2)C=C1 |
InChi: | InChI=1S/C18H12Cl2N2O2/c19-12-6-7-14(16(20)9-12)18(24)22-21-10-15-13-4-2-1-3-11(13)5-8-17(15)23/h1-10,23H,(H,22,24)/b21-10+ |
InChiKey: | InChIKey=JNADVWZAPKIQHR-UFFVCSGVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.