* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB019129 |
English Synonyms: | VITAS-BB TBB019129 |
MDL Number.: | MFCD00616433 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | O=C(NC1=C(C#N)C2=C(CCCC2)S1)C1=C2C=CC=CC2=NC(=C1)C1=CC=CC=C1 |
InChi: | InChI=1S/C25H19N3OS/c26-15-20-18-11-5-7-13-23(18)30-25(20)28-24(29)19-14-22(16-8-2-1-3-9-16)27-21-12-6-4-10-17(19)21/h1-4,6,8-10,12,14H,5,7,11,13H2,(H,28,29) |
InChiKey: | InChIKey=QCWBFSLFNSNTIN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.