* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | VITAS-BB TBB023386 |
English Synonyms: | VITAS-BB TBB023386 |
MDL Number.: | MFCD00616466 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | ClC1=C(SC2=C1C=CC=C2)C(=O)NN=C1CCN(CC2=CC=CC=C2)CC1 |
InChi: | InChI=1S/C21H20ClN3OS/c22-19-17-8-4-5-9-18(17)27-20(19)21(26)24-23-16-10-12-25(13-11-16)14-15-6-2-1-3-7-15/h1-9H,10-14H2,(H,24,26) |
InChiKey: | InChIKey=UGKCEIMOAUTXHA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.