* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/6022204 |
English Synonyms: | ZERENEX E/6022204 |
MDL Number.: | MFCD00617444 |
H bond acceptor: | 8 |
H bond donor: | 2 |
Smile: | COc1ccc(c(c1)OC)/C=N/NC(=O)Nc2cccc3c2nsn3 |
InChi: | InChI=1S/C16H15N5O3S/c1-23-11-7-6-10(14(8-11)24-2)9-17-19-16(22)18-12-4-3-5-13-15(12)21-25-20-13/h3-9H,1-2H3,(H2,18,19,22)/b17-9+ |
InChiKey: | InChIKey=XIFUUXSQUOEBOX-RQZCQDPDSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.