* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035352 |
| English Synonyms: | VITAS-BB TBB035352 |
| MDL Number.: | MFCD00619574 |
| H bond acceptor: | 8 |
| H bond donor: | 3 |
| Smile: | COC1=C(O)C(Br)=CC(=C1)C1NC(=O)NC(C)=C1C(=O)OCCOC1=CC=CC=C1 |
| InChi: | InChI=1S/C21H21BrN2O6/c1-12-17(20(26)30-9-8-29-14-6-4-3-5-7-14)18(24-21(27)23-12)13-10-15(22)19(25)16(11-13)28-2/h3-7,10-11,18,25H,8-9H2,1-2H3,(H2,23,24,27) |
| InChiKey: | InChIKey=AUUUGQXRYKBRHV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.