* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035353 |
English Synonyms: | VITAS-BB TBB035353 |
MDL Number.: | MFCD00619577 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CC1=C(C(NC(=O)N1)C1=CC=CC(F)=C1)C(=O)OCCOC1=CC=CC=C1 |
InChi: | InChI=1S/C20H19FN2O4/c1-13-17(19(24)27-11-10-26-16-8-3-2-4-9-16)18(23-20(25)22-13)14-6-5-7-15(21)12-14/h2-9,12,18H,10-11H2,1H3,(H2,22,23,25) |
InChiKey: | InChIKey=LJQJRAPSNUOHEM-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.