* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035888 |
| English Synonyms: | VITAS-BB TBB035888 |
| MDL Number.: | MFCD00619593 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | COCCOC(=O)C1=C(C)NC(=O)NC1C1=CC=C(C=C1)[N+]([O-])=O |
| InChi: | InChI=1S/C15H17N3O6/c1-9-12(14(19)24-8-7-23-2)13(17-15(20)16-9)10-3-5-11(6-4-10)18(21)22/h3-6,13H,7-8H2,1-2H3,(H2,16,17,20) |
| InChiKey: | InChIKey=IZMCEPBVFRXWOR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.