* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | ZERENEX E/6010026 |
English Synonyms: | ZERENEX E/6010026 |
MDL Number.: | MFCD00621702 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | c1ccc(cc1)C(=O)Nc2ccc3c(c2NC(=O)c4ccccc4)nsn3 |
InChi: | InChI=1S/C20H14N4O2S/c25-19(13-7-3-1-4-8-13)21-15-11-12-16-18(24-27-23-16)17(15)22-20(26)14-9-5-2-6-10-14/h1-12H,(H,21,25)(H,22,26) |
InChiKey: | InChIKey=CSBBOEZSGAKSEX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.