Molecular Structure:
CCD No.:CCD00145676
ZERENEX E/6010007
Formula:C13 H9 N5 O2 S3
MolWeight:363.445
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | ZERENEX E/6010007 |
| English Synonyms： | ZERENEX E/6010007 |
| MDL Number.： | MFCD00621703 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | Cc1ccc2c(c1S(=O)(=O)Nc3cccc4c3nsn4)nsn2 |
| InChi： | InChI=1S/C13H9N5O2S3/c1-7-5-6-9-12(17-22-15-9)13(7)23(19,20)18-10-4-2-3-8-11(10)16-21-14-8/h2-6,18H,1H3 |
| InChiKey： | InChIKey=KOLIKVQLPZTLCK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
