* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB023306 |
English Synonyms: | VITAS-BB TBB023306 |
MDL Number.: | MFCD00622191 |
H bond acceptor: | 3 |
H bond donor: | 1 |
Smile: | ClC1=C(SC2=C1C=CC=C2)C(=O)NN=C1CCCC1 |
InChi: | InChI=1S/C14H13ClN2OS/c15-12-10-7-3-4-8-11(10)19-13(12)14(18)17-16-9-5-1-2-6-9/h3-4,7-8H,1-2,5-6H2,(H,17,18) |
InChiKey: | InChIKey=SSMUZTAHBRYHGI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.