* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB028228 |
English Synonyms: | VITAS-BB TBB028228 |
MDL Number.: | MFCD00622210 |
H bond acceptor: | 4 |
H bond donor: | 1 |
Smile: | CC1CCC2=C(C1)SC(NC(=O)\C=C\C1=CC=CO1)=C2C#N |
InChi: | InChI=1S/C17H16N2O2S/c1-11-4-6-13-14(10-18)17(22-15(13)9-11)19-16(20)7-5-12-3-2-8-21-12/h2-3,5,7-8,11H,4,6,9H2,1H3,(H,19,20)/b7-5+ |
InChiKey: | InChIKey=DRMFKUZSPMTKPN-FNORWQNLSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.