* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | VITAS-BB TBB035831 |
English Synonyms: | VITAS-BB TBB035831 |
MDL Number.: | MFCD00622822 |
H bond acceptor: | 7 |
H bond donor: | 2 |
Smile: | CCCCCOC(=O)C1=C(C)NC(=O)NC1C1=CC=C2OCOC2=C1 |
InChi: | InChI=1S/C18H22N2O5/c1-3-4-5-8-23-17(21)15-11(2)19-18(22)20-16(15)12-6-7-13-14(9-12)25-10-24-13/h6-7,9,16H,3-5,8,10H2,1-2H3,(H2,19,20,22) |
InChiKey: | InChIKey=JIVAERJCLFTJMG-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.