* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB014741 |
| English Synonyms: | VITAS-BB TBB014741 |
| MDL Number.: | MFCD00624579 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | N\C(=C/C1=[N+](CCCS([O-])(=O)=O)C2=C(S1)C=CC=C2)\C=C1/SC2=C(C=CC=C2)N1CCCS(O)(=O)=O |
| InChi: | InChI=1S/C23H25N3O6S4/c24-17(15-22-25(11-5-13-35(27,28)29)18-7-1-3-9-20(18)33-22)16-23-26(12-6-14-36(30,31)32)19-8-2-4-10-21(19)34-23/h1-4,7-10,15-16,24H,5-6,11-14H2,(H2,27,28,29,30,31,32)/b22-15- |
| InChiKey: | InChIKey=UUAZZQHFSVVUDU-JCMHNJIXSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.