* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | VITAS-BB TBB035904 |
| English Synonyms: | VITAS-BB TBB035904 |
| MDL Number.: | MFCD00625118 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | COC1=CC=C(C2C(C(=O)OCC3=CC=CC=C3)=C(C)NC3=C2C(=O)CC(C)(C)C3)C(OC)=C1 |
| InChi: | InChI=1S/C28H31NO5/c1-17-24(27(31)34-16-18-9-7-6-8-10-18)25(20-12-11-19(32-4)13-23(20)33-5)26-21(29-17)14-28(2,3)15-22(26)30/h6-13,25,29H,14-16H2,1-5H3 |
| InChiKey: | InChIKey=MQXIUKWKGRQJLW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.